C27H30ClN5O2 — CID 144853075
N-[(4R)-6-(4-chlorophenyl)-8-hydroxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-2,2,4,4-tetramethylhex-5-enamide (PubChem CID 144853075) has the molecular formula C27H30ClN5O2 and a molecular weight of 492.02 g/mol. Its IUPAC name is N-[(4R)-6-(4-chlorophenyl)-8-hydroxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-2,2,4,4-tetramethylhex-5-enamide.
| Compound Name | N-[(4R)-6-(4-chlorophenyl)-8-hydroxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-2,2,4,4-tetramethylhex-5-enamide |
|---|---|
| PubChem CID | 144853075 |
| Molecular Formula | C27H30ClN5O2 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-[(4R)-6-(4-chlorophenyl)-8-hydroxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-2,2,4,4-tetramethylhex-5-enamide |
| SMILES | C=CC(C)(C)CC(C)(C)C(=O)N[C@@H]1N=C(c2ccc(Cl)cc2)c2cc(O)ccc2-n2c(C)nnc21 |
| InChI | InChI=1S/C27H30ClN5O2/c1-7-26(3,4)15-27(5,6)25(35)30-23-24-32-31-16(2)33(24)21-13-12-19(34)14-20(21)22(29-23)17-8-10-18(28)11-9-17/h7-14,23,34H,1,15H2,2-6H3,(H,30,35)/t23-/m0/s1 |
| InChIKey | LNRGJHUJMKDDLC-QHCPKHFHSA-N |
| XLogP | 5.53 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|