C11H21ClFN2O13P3 — CID 144853941
[[(4S)-4-chloro-4-[[(E)-2-fluoro-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxypentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 144853941) has the molecular formula C11H21ClFN2O13P3 and a molecular weight of 536.66 g/mol. Its IUPAC name is [[(4S)-4-chloro-4-[[(E)-2-fluoro-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxypentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(4S)-4-chloro-4-[[(E)-2-fluoro-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxypentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 144853941 |
| Molecular Formula | C11H21ClFN2O13P3 |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | [[(4S)-4-chloro-4-[[(E)-2-fluoro-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methoxypentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@](C)(Cl)N(C)/C=C(/F)C(=O)NC=O |
| InChI | InChI=1S/C11H21ClFN2O13P3/c1-11(12,15(2)5-9(13)10(17)14-7-16)4-8(25-3)6-26-30(21,22)28-31(23,24)27-29(18,19)20/h5,7-8H,4,6H2,1-3H3,(H,21,22)(H,23,24)(H,14,16,17)(H2,18,19,20)/b9-5+/t8?,11-/m1/s1 |
| InChIKey | ARMRFXWKBGNHFY-ZGWXGTDOSA-N |
| XLogP | 0.71 |
| TPSA | 218.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|