C24H43ClN3O8PS — CID 144853992
propan-2-yl 2-[[[4-chloro-4-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2-methoxybutoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]amino]propanoate (PubChem CID 144853992) has the molecular formula C24H43ClN3O8PS and a molecular weight of 600.12 g/mol. Its IUPAC name is propan-2-yl 2-[[[4-chloro-4-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2-methoxybutoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4-chloro-4-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2-methoxybutoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 144853992 |
| Molecular Formula | C24H43ClN3O8PS |
| Molecular Weight | 600.12 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | propan-2-yl 2-[[[4-chloro-4-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2-methoxybutoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]amino]propanoate |
| SMILES | COC(COP(NC(C)C(=O)OC(C)C)OCCSC(=O)C(C)(C)C)CC(Cl)N(C)/C=C(/C)C(=O)NC=O |
| InChI | InChI=1S/C24H43ClN3O8PS/c1-16(2)36-22(31)18(4)27-37(34-10-11-38-23(32)24(5,6)7)35-14-19(33-9)12-20(25)28(8)13-17(3)21(30)26-15-29/h13,15-16,18-20,27H,10-12,14H2,1-9H3,(H,26,29,30)/b17-13- |
| InChIKey | HMUOEVZORNWSHS-LGMDPLHJSA-N |
| XLogP | 3.56 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|