C32H51NO6 — CID 144854099
(1R,6R,9S,14S)-20-[[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy]-6,23-dimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one (PubChem CID 144854099) has the molecular formula C32H51NO6 and a molecular weight of 545.76 g/mol. Its IUPAC name is (1R,6R,9S,14S)-20-[[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy]-6,23-dimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one.
| Compound Name | (1R,6R,9S,14S)-20-[[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy]-6,23-dimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one |
|---|---|
| PubChem CID | 144854099 |
| Molecular Formula | C32H51NO6 |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.37 |
| IUPAC Name | (1R,6R,9S,14S)-20-[[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy]-6,23-dimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one |
| SMILES | C[C@@H]1CC[C@H]2CC3CC[C@H]4C5CC(=O)C6CC(OCC7OC(CO)C(O)C7O)CCC6(C)C5C[C@H]4C3CN2C1 |
| InChI | InChI=1S/C32H51NO6/c1-17-3-5-19-9-18-4-6-21-22(24(18)14-33(19)13-17)11-25-23(21)12-27(35)26-10-20(7-8-32(25,26)2)38-16-29-31(37)30(36)28(15-34)39-29/h17-26,28-31,34,36-37H,3-16H2,1-2H3/t17-,18?,19+,20?,21-,22-,23?,24?,25?,26?,28?,29?,30?,31?,32?/m1/s1 |
| InChIKey | MMAGSMNYIJAYPW-ZBBYWKJRSA-N |
| XLogP | 3.03 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |