C30H42N4O2S — CID 144854450
(1R,2S,6R,7S)-4-[2-[(1S,2R)-2-[[4-[(E)-C-(2-methylphenyl)-N-sulfanylcarbonimidoyl]piperazin-1-yl]methyl]cyclohexyl]ethyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 144854450) has the molecular formula C30H42N4O2S and a molecular weight of 522.76 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-[2-[(1S,2R)-2-[[4-[(E)-C-(2-methylphenyl)-N-sulfanylcarbonimidoyl]piperazin-1-yl]methyl]cyclohexyl]ethyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-[2-[(1S,2R)-2-[[4-[(E)-C-(2-methylphenyl)-N-sulfanylcarbonimidoyl]piperazin-1-yl]methyl]cyclohexyl]ethyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 144854450 |
| Molecular Formula | C30H42N4O2S |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (1R,2S,6R,7S)-4-[2-[(1S,2R)-2-[[4-[(E)-C-(2-methylphenyl)-N-sulfanylcarbonimidoyl]piperazin-1-yl]methyl]cyclohexyl]ethyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1ccccc1/C(=N\S)N1CCN(C[C@@H]2CCCC[C@H]2CCN2C(=O)[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3C2=O)CC1 |
| InChI | InChI=1S/C30H42N4O2S/c1-20-6-2-5-9-25(20)28(31-37)33-16-14-32(15-17-33)19-24-8-4-3-7-21(24)12-13-34-29(35)26-22-10-11-23(18-22)27(26)30(34)36/h2,5-6,9,21-24,26-27,37H,3-4,7-8,10-19H2,1H3/b31-28+/t21-,22-,23+,24-,26+,27-/m0/s1 |
| InChIKey | GZKWVYXXSQCBIO-PNEXJSGCSA-N |
| XLogP | 4.43 |
| TPSA | 56.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|