About 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole
3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole (PubChem CID 144855128) has the molecular formula C20H27FN2
and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole.
Molecular Properties
| Compound Name | 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole |
| PubChem CID | 144855128 |
| Molecular Formula | C20H27FN2 |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole |
| SMILES | C=C(CC1CC1)N1CCC(C2=CNC3=CC(F)=CCC32C)CC1 |
| InChI | InChI=1S/C20H27FN2/c1-14(11-15-3-4-15)23-9-6-16(7-10-23)18-13-22-19-12-17(21)5-8-20(18,19)2/h5,12-13,15-16,22H,1,3-4,6-11H2,2H3 |
| InChIKey | SUKNXKXDMSGUAN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole?
The IUPAC name of 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole (CID 144855128) is 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole.
What is the SMILES notation for 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole?
The canonical SMILES for 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole is C=C(CC1CC1)N1CCC(C2=CNC3=CC(F)=CCC32C)CC1.
What is the InChIKey of 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole?
The InChIKey is SUKNXKXDMSGUAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27FN2/c1-14(11-15-3-4-15)23-9-6-16(7-10-23)18-13-22-19-12-17(21)5-8-20(18,19)2/h5,12-13,15-16,22H,1,3-4,6-11H2,2H3.
What are the key properties of 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole?
3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole has a molecular weight of 314.45 g/mol, XLogP of 4.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3-cyclopropylprop-1-en-2-yl)piperidin-4-yl]-6-fluoro-3a-methyl-1,4-dihydroindole is sourced from PubChem (CID 144855128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).