About 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane
5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane (PubChem CID 144855581) has the molecular formula C11H16ClN3
and a molecular weight of 225.72 g/mol. Its IUPAC name is 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane.
Molecular Properties
| Compound Name | 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane |
| PubChem CID | 144855581 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane |
| SMILES | CCC.Cc1ncnc2c1C(Cl)=CNC2 |
| InChI | InChI=1S/C8H8ClN3.C3H8/c1-5-8-6(9)2-10-3-7(8)12-4-11-5;1-3-2/h2,4,10H,3H2,1H3;3H2,1-2H3 |
| InChIKey | GYSDOQYOOKWXDM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane?
The IUPAC name of 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane (CID 144855581) is 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane.
What is the SMILES notation for 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane?
The canonical SMILES for 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane is CCC.Cc1ncnc2c1C(Cl)=CNC2.
What is the InChIKey of 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane?
The InChIKey is GYSDOQYOOKWXDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3.C3H8/c1-5-8-6(9)2-10-3-7(8)12-4-11-5;1-3-2/h2,4,10H,3H2,1H3;3H2,1-2H3.
What are the key properties of 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane?
5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane has a molecular weight of 225.72 g/mol, XLogP of 2.84, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-methyl-7,8-dihydropyrido[3,4-d]pyrimidine;propane is sourced from PubChem (CID 144855581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).