About N-butylformamide;2-methyl-5-(4-methylphenyl)furan
N-butylformamide;2-methyl-5-(4-methylphenyl)furan (PubChem CID 144855927) has the molecular formula C17H23NO2
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-butylformamide;2-methyl-5-(4-methylphenyl)furan.
Molecular Properties
| Compound Name | N-butylformamide;2-methyl-5-(4-methylphenyl)furan |
| PubChem CID | 144855927 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-butylformamide;2-methyl-5-(4-methylphenyl)furan |
| SMILES | CCCCNC=O.Cc1ccc(-c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C12H12O.C5H11NO/c1-9-3-6-11(7-4-9)12-8-5-10(2)13-12;1-2-3-4-6-5-7/h3-8H,1-2H3;5H,2-4H2,1H3,(H,6,7) |
| InChIKey | CTEJFUXUWWIUIK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylformamide;2-methyl-5-(4-methylphenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylformamide;2-methyl-5-(4-methylphenyl)furan?
The IUPAC name of N-butylformamide;2-methyl-5-(4-methylphenyl)furan (CID 144855927) is N-butylformamide;2-methyl-5-(4-methylphenyl)furan.
What is the SMILES notation for N-butylformamide;2-methyl-5-(4-methylphenyl)furan?
The canonical SMILES for N-butylformamide;2-methyl-5-(4-methylphenyl)furan is CCCCNC=O.Cc1ccc(-c2ccc(C)o2)cc1.
What is the InChIKey of N-butylformamide;2-methyl-5-(4-methylphenyl)furan?
The InChIKey is CTEJFUXUWWIUIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O.C5H11NO/c1-9-3-6-11(7-4-9)12-8-5-10(2)13-12;1-2-3-4-6-5-7/h3-8H,1-2H3;5H,2-4H2,1H3,(H,6,7).
What are the key properties of N-butylformamide;2-methyl-5-(4-methylphenyl)furan?
N-butylformamide;2-methyl-5-(4-methylphenyl)furan has a molecular weight of 273.38 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylformamide;2-methyl-5-(4-methylphenyl)furan is sourced from PubChem (CID 144855927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).