C21H23N3O3S — CID 144857347
(3R,3aR,6aS)-5-(4-methylphenyl)-4,6-dioxo-N-phenyl-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxamide;methanethiol (PubChem CID 144857347) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is (3R,3aR,6aS)-5-(4-methylphenyl)-4,6-dioxo-N-phenyl-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxamide;methanethiol.
| Compound Name | (3R,3aR,6aS)-5-(4-methylphenyl)-4,6-dioxo-N-phenyl-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxamide;methanethiol |
|---|---|
| PubChem CID | 144857347 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (3R,3aR,6aS)-5-(4-methylphenyl)-4,6-dioxo-N-phenyl-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxamide;methanethiol |
| SMILES | CS.Cc1ccc(N2C(=O)[C@@H]3[C@@H](CN[C@H]3C(=O)Nc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H19N3O3.CH4S/c1-12-7-9-14(10-8-12)23-19(25)15-11-21-17(16(15)20(23)26)18(24)22-13-5-3-2-4-6-13;1-2/h2-10,15-17,21H,11H2,1H3,(H,22,24);2H,1H3/t15-,16-,17-;/m1./s1 |
| InChIKey | ITCYWJFRALYJCU-UATJXVQHSA-N |
| XLogP | 2.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|