C42H47F2N7O — CID 144858278
2-fluoro-6-[3-[4-[(6-fluoro-2-methoxyacridin-9-yl)amino]piperidin-1-yl]propyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine (PubChem CID 144858278) has the molecular formula C42H47F2N7O and a molecular weight of 703.88 g/mol. Its IUPAC name is 2-fluoro-6-[3-[4-[(6-fluoro-2-methoxyacridin-9-yl)amino]piperidin-1-yl]propyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine.
| Compound Name | 2-fluoro-6-[3-[4-[(6-fluoro-2-methoxyacridin-9-yl)amino]piperidin-1-yl]propyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine |
|---|---|
| PubChem CID | 144858278 |
| Molecular Formula | C42H47F2N7O |
| Molecular Weight | 703.88 g/mol |
| Exact Mass | 703.38 |
| IUPAC Name | 2-fluoro-6-[3-[4-[(6-fluoro-2-methoxyacridin-9-yl)amino]piperidin-1-yl]propyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine |
| SMILES | COc1ccc2nc3cc(F)ccc3c(NC3CCN(CCCc4ccc5c(NCCN6CCN(C)CC6)c6cc(F)ccc6nc5c4)CC3)c2c1 |
| InChI | InChI=1S/C42H47F2N7O/c1-49-20-22-51(23-21-49)19-15-45-41-33-9-5-28(24-39(33)47-37-11-7-29(43)25-35(37)41)4-3-16-50-17-13-31(14-18-50)46-42-34-10-6-30(44)26-40(34)48-38-12-8-32(52-2)27-36(38)42/h5-12,24-27,31H,3-4,13-23H2,1-2H3,(H,45,47)(H,46,48) |
| InChIKey | ROHKIIVLCXKEFK-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.88 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|