C22H33NO2 — CID 144858292
(3E,5E,7E)-3-methoxy-N-(2-methoxyethyl)-10-methyl-5,7-bis(prop-1-en-2-yl)undeca-1,3,5,7,9-pentaen-6-amine (PubChem CID 144858292) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (3E,5E,7E)-3-methoxy-N-(2-methoxyethyl)-10-methyl-5,7-bis(prop-1-en-2-yl)undeca-1,3,5,7,9-pentaen-6-amine.
| Compound Name | (3E,5E,7E)-3-methoxy-N-(2-methoxyethyl)-10-methyl-5,7-bis(prop-1-en-2-yl)undeca-1,3,5,7,9-pentaen-6-amine |
|---|---|
| PubChem CID | 144858292 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (3E,5E,7E)-3-methoxy-N-(2-methoxyethyl)-10-methyl-5,7-bis(prop-1-en-2-yl)undeca-1,3,5,7,9-pentaen-6-amine |
| SMILES | C=C/C(=C\C(C(=C)C)=C(NCCOC)\C(=C\C=C(C)C)C(=C)C)OC |
| InChI | InChI=1S/C22H33NO2/c1-10-19(25-9)15-21(18(6)7)22(23-13-14-24-8)20(17(4)5)12-11-16(2)3/h10-12,15,23H,1,4,6,13-14H2,2-3,5,7-9H3/b19-15+,20-12+,22-21+ |
| InChIKey | QJYBCVKXPJXFDO-UIPGEZASSA-N |
| XLogP | 5.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|