About (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine
(3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine (PubChem CID 144858385) has the molecular formula C17H30N2O
and a molecular weight of 278.44 g/mol. Its IUPAC name is (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine.
Molecular Properties
| Compound Name | (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine |
| PubChem CID | 144858385 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine |
| SMILES | C=C(/C=C(/C)C(=C)NCCCC)C(=C)OCCNCC |
| InChI | InChI=1S/C17H30N2O/c1-7-9-10-19-16(5)14(3)13-15(4)17(6)20-12-11-18-8-2/h13,18-19H,4-12H2,1-3H3/b14-13- |
| InChIKey | WZLBMZZGHHIMMY-YPKPFQOOSA-N |
| XLogP | 3.53 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine?
The IUPAC name of (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine (CID 144858385) is (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine.
What is the SMILES notation for (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine?
The canonical SMILES for (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine is C=C(/C=C(/C)C(=C)NCCCC)C(=C)OCCNCC.
What is the InChIKey of (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine?
The InChIKey is WZLBMZZGHHIMMY-YPKPFQOOSA-N. The full InChI is InChI=1S/C17H30N2O/c1-7-9-10-19-16(5)14(3)13-15(4)17(6)20-12-11-18-8-2/h13,18-19H,4-12H2,1-3H3/b14-13-.
What are the key properties of (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine?
(3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine has a molecular weight of 278.44 g/mol, XLogP of 3.53, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-butyl-6-[2-(ethylamino)ethoxy]-3-methyl-5-methylidenehepta-1,3,6-trien-2-amine is sourced from PubChem (CID 144858385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).