C17H32N3O7P — CID 144858397
[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethyl-(3-hexoxypropoxy)phosphinic acid (PubChem CID 144858397) has the molecular formula C17H32N3O7P and a molecular weight of 421.43 g/mol. Its IUPAC name is [1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethyl-(3-hexoxypropoxy)phosphinic acid.
| Compound Name | [1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethyl-(3-hexoxypropoxy)phosphinic acid |
|---|---|
| PubChem CID | 144858397 |
| Molecular Formula | C17H32N3O7P |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | [1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethyl-(3-hexoxypropoxy)phosphinic acid |
| SMILES | CCCCCCOCCCOP(=O)(O)COC(CO)Cn1ccc(N)nc1=O |
| InChI | InChI=1S/C17H32N3O7P/c1-2-3-4-5-9-25-10-6-11-27-28(23,24)14-26-15(13-21)12-20-8-7-16(18)19-17(20)22/h7-8,15,21H,2-6,9-14H2,1H3,(H,23,24)(H2,18,19,22) |
| InChIKey | YKNPLFBKRMLDAH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|