C9H6FN3O2 — CID 144858847
5-fluoro-4-hydroxy-2-pyridin-2-yl-1H-pyrimidin-6-one (PubChem CID 144858847) has the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. Its IUPAC name is 5-fluoro-4-hydroxy-2-pyridin-2-yl-1H-pyrimidin-6-one.
| Compound Name | 5-fluoro-4-hydroxy-2-pyridin-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 144858847 |
| Molecular Formula | C9H6FN3O2 |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 5-fluoro-4-hydroxy-2-pyridin-2-yl-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2ccccn2)nc(O)c1F |
| InChI | InChI=1S/C9H6FN3O2/c10-6-8(14)12-7(13-9(6)15)5-3-1-2-4-11-5/h1-4H,(H2,12,13,14,15) |
| InChIKey | PJMUXYXKGXMOGF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |