About 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine
4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine (PubChem CID 144859107) has the molecular formula C19H34N2O
and a molecular weight of 306.49 g/mol. Its IUPAC name is 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine.
Molecular Properties
| Compound Name | 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine |
| PubChem CID | 144859107 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine |
| SMILES | C=C(NCCC)OC(C)(C)C.CC[C@@H](C)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H15N.C9H19NO/c1-3-8(2)9-4-6-10(11)7-5-9;1-6-7-10-8(2)11-9(3,4)5/h4-8H,3,11H2,1-2H3;10H,2,6-7H2,1,3-5H3/t8-;/m1./s1 |
| InChIKey | QJEFWGVQFAKVLK-DDWIOCJRSA-N |
| XLogP | 5.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine?
The IUPAC name of 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine (CID 144859107) is 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine.
What is the SMILES notation for 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine?
The canonical SMILES for 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine is C=C(NCCC)OC(C)(C)C.CC[C@@H](C)c1ccc(N)cc1.
What is the InChIKey of 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine?
The InChIKey is QJEFWGVQFAKVLK-DDWIOCJRSA-N. The full InChI is InChI=1S/C10H15N.C9H19NO/c1-3-8(2)9-4-6-10(11)7-5-9;1-6-7-10-8(2)11-9(3,4)5/h4-8H,3,11H2,1-2H3;10H,2,6-7H2,1,3-5H3/t8-;/m1./s1.
What are the key properties of 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine?
4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine has a molecular weight of 306.49 g/mol, XLogP of 5.05, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-butan-2-yl]aniline;N-[1-[(2-methylpropan-2-yl)oxy]ethenyl]propan-1-amine is sourced from PubChem (CID 144859107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).