About 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one
8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one (PubChem CID 144861924) has the molecular formula C19H15ClN2O2S
and a molecular weight of 370.86 g/mol. Its IUPAC name is 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one.
Molecular Properties
| Compound Name | 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one |
| PubChem CID | 144861924 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one |
| SMILES | Cc1c(-c2ccc(S(C)=O)cc2)c2[nH]c3ccc(Cl)cc3c2[nH]c1=O |
| InChI | InChI=1S/C19H15ClN2O2S/c1-10-16(11-3-6-13(7-4-11)25(2)24)18-17(22-19(10)23)14-9-12(20)5-8-15(14)21-18/h3-9,21H,1-2H3,(H,22,23) |
| InChIKey | PRSJTGQQSVIUGC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one?
The IUPAC name of 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one (CID 144861924) is 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one.
What is the SMILES notation for 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one?
The canonical SMILES for 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one is Cc1c(-c2ccc(S(C)=O)cc2)c2[nH]c3ccc(Cl)cc3c2[nH]c1=O.
What is the InChIKey of 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one?
The InChIKey is PRSJTGQQSVIUGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN2O2S/c1-10-16(11-3-6-13(7-4-11)25(2)24)18-17(22-19(10)23)14-9-12(20)5-8-15(14)21-18/h3-9,21H,1-2H3,(H,22,23).
What are the key properties of 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one?
8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one has a molecular weight of 370.86 g/mol, XLogP of 4.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-3-methyl-4-(4-methylsulfinylphenyl)-1,5-dihydropyrido[3,2-b]indol-2-one is sourced from PubChem (CID 144861924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).