C25H24F5N7O — CID 144862220
4-amino-5-methyl-2-[2-(3,3,4,4,4-pentafluorobutyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-one;ethane (PubChem CID 144862220) has the molecular formula C25H24F5N7O and a molecular weight of 533.51 g/mol. Its IUPAC name is 4-amino-5-methyl-2-[2-(3,3,4,4,4-pentafluorobutyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-one;ethane.
| Compound Name | 4-amino-5-methyl-2-[2-(3,3,4,4,4-pentafluorobutyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-one;ethane |
|---|---|
| PubChem CID | 144862220 |
| Molecular Formula | C25H24F5N7O |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 4-amino-5-methyl-2-[2-(3,3,4,4,4-pentafluorobutyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-one;ethane |
| SMILES | CC.CC1(c2ccccc2)C(=O)Nc2nc(-c3nc(CCC(F)(F)C(F)(F)F)nc4[nH]ccc34)nc(N)c21 |
| InChI | InChI=1S/C23H18F5N7O.C2H6/c1-21(11-5-3-2-4-6-11)14-16(29)33-19(34-18(14)35-20(21)36)15-12-8-10-30-17(12)32-13(31-15)7-9-22(24,25)23(26,27)28;1-2/h2-6,8,10H,7,9H2,1H3,(H,30,31,32)(H3,29,33,34,35,36);1-2H3 |
| InChIKey | AGVZWQJBZKYJJR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|