C14H23F3N2O — CID 144862601
ethane;5-methyl-1-[2-(oxan-4-yl)ethyl]-3-(trifluoromethyl)pyrazole (PubChem CID 144862601) has the molecular formula C14H23F3N2O and a molecular weight of 292.34 g/mol. Its IUPAC name is ethane;5-methyl-1-[2-(oxan-4-yl)ethyl]-3-(trifluoromethyl)pyrazole.
| Compound Name | ethane;5-methyl-1-[2-(oxan-4-yl)ethyl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 144862601 |
| Molecular Formula | C14H23F3N2O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | ethane;5-methyl-1-[2-(oxan-4-yl)ethyl]-3-(trifluoromethyl)pyrazole |
| SMILES | CC.Cc1cc(C(F)(F)F)nn1CCC1CCOCC1 |
| InChI | InChI=1S/C12H17F3N2O.C2H6/c1-9-8-11(12(13,14)15)16-17(9)5-2-10-3-6-18-7-4-10;1-2/h8,10H,2-7H2,1H3;1-2H3 |
| InChIKey | DTEWNNNFBNAKOM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |