C12H15F5N2O2 — CID 144862697
cyclohexa-1,5-dien-1-ylmethyl N-(3,3,4,4,4-pentafluorobutylamino)carbamate (PubChem CID 144862697) has the molecular formula C12H15F5N2O2 and a molecular weight of 314.25 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl N-(3,3,4,4,4-pentafluorobutylamino)carbamate.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl N-(3,3,4,4,4-pentafluorobutylamino)carbamate |
|---|---|
| PubChem CID | 144862697 |
| Molecular Formula | C12H15F5N2O2 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl N-(3,3,4,4,4-pentafluorobutylamino)carbamate |
| SMILES | O=C(NNCCC(F)(F)C(F)(F)F)OCC1=CCCC=C1 |
| InChI | InChI=1S/C12H15F5N2O2/c13-11(14,12(15,16)17)6-7-18-19-10(20)21-8-9-4-2-1-3-5-9/h2,4-5,18H,1,3,6-8H2,(H,19,20) |
| InChIKey | HUZRDYOHWVTGHA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|