C23H25F3N4O — CID 144862826
4-[1-[3-(propylamino)propyl]-5-(3,3,3-trifluoropropoxy)pyrrolo[3,2-b]pyridin-6-yl]benzonitrile (PubChem CID 144862826) has the molecular formula C23H25F3N4O and a molecular weight of 430.47 g/mol. Its IUPAC name is 4-[1-[3-(propylamino)propyl]-5-(3,3,3-trifluoropropoxy)pyrrolo[3,2-b]pyridin-6-yl]benzonitrile.
| Compound Name | 4-[1-[3-(propylamino)propyl]-5-(3,3,3-trifluoropropoxy)pyrrolo[3,2-b]pyridin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 144862826 |
| Molecular Formula | C23H25F3N4O |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-[1-[3-(propylamino)propyl]-5-(3,3,3-trifluoropropoxy)pyrrolo[3,2-b]pyridin-6-yl]benzonitrile |
| SMILES | CCCNCCCn1ccc2nc(OCCC(F)(F)F)c(-c3ccc(C#N)cc3)cc21 |
| InChI | InChI=1S/C23H25F3N4O/c1-2-10-28-11-3-12-30-13-8-20-21(30)15-19(18-6-4-17(16-27)5-7-18)22(29-20)31-14-9-23(24,25)26/h4-8,13,15,28H,2-3,9-12,14H2,1H3 |
| InChIKey | LRFRTRIEULXFQO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|