About (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal
(Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal (PubChem CID 144863223) has the molecular formula C12H20OS
and a molecular weight of 212.36 g/mol. Its IUPAC name is (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal.
Molecular Properties
| Compound Name | (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal |
| PubChem CID | 144863223 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal |
| SMILES | C/C=C(/C=O)SC(=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H20OS/c1-7-10(8-13)14-11(9(2)3)12(4,5)6/h7-8H,1-6H3/b10-7- |
| InChIKey | QGHARJCLVAHMNI-YFHOEESVSA-N |
| XLogP | 4.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal?
The IUPAC name of (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal (CID 144863223) is (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal.
What is the SMILES notation for (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal?
The canonical SMILES for (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal is C/C=C(/C=O)SC(=C(C)C)C(C)(C)C.
What is the InChIKey of (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal?
The InChIKey is QGHARJCLVAHMNI-YFHOEESVSA-N. The full InChI is InChI=1S/C12H20OS/c1-7-10(8-13)14-11(9(2)3)12(4,5)6/h7-8H,1-6H3/b10-7-.
What are the key properties of (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal?
(Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal has a molecular weight of 212.36 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2,4,4-trimethylpent-2-en-3-ylsulfanyl)but-2-enal is sourced from PubChem (CID 144863223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).