C34H33F2N3O — CID 144863764
5-[3-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yloxymethyl)-2,4-difluorophenyl]-4,6-dimethyl-2-(4-phenylpiperidin-1-yl)pyrimidine (PubChem CID 144863764) has the molecular formula C34H33F2N3O and a molecular weight of 537.65 g/mol. Its IUPAC name is 5-[3-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yloxymethyl)-2,4-difluorophenyl]-4,6-dimethyl-2-(4-phenylpiperidin-1-yl)pyrimidine.
| Compound Name | 5-[3-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yloxymethyl)-2,4-difluorophenyl]-4,6-dimethyl-2-(4-phenylpiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 144863764 |
| Molecular Formula | C34H33F2N3O |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 5-[3-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yloxymethyl)-2,4-difluorophenyl]-4,6-dimethyl-2-(4-phenylpiperidin-1-yl)pyrimidine |
| SMILES | Cc1nc(N2CCC(c3ccccc3)CC2)nc(C)c1-c1ccc(F)c(COc2ccc3c(c2)CC2CC32)c1F |
| InChI | InChI=1S/C34H33F2N3O/c1-20-32(21(2)38-34(37-20)39-14-12-23(13-15-39)22-6-4-3-5-7-22)28-10-11-31(35)30(33(28)36)19-40-26-8-9-27-24(17-26)16-25-18-29(25)27/h3-11,17,23,25,29H,12-16,18-19H2,1-2H3 |
| InChIKey | TZHIVYRPJZODKG-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |