About ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate
ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 14486436) has the molecular formula C8H10N2O3S
and a molecular weight of 214.25 g/mol. Its IUPAC name is ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 14486436 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC=O)nc1C |
| InChI | InChI=1S/C8H10N2O3S/c1-3-13-7(12)6-5(2)10-8(14-6)9-4-11/h4H,3H2,1-2H3,(H,9,10,11) |
| InChIKey | PSGBDJJLXGYBOQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate (CID 14486436) is ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(NC=O)nc1C.
What is the InChIKey of ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is PSGBDJJLXGYBOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-3-13-7(12)6-5(2)10-8(14-6)9-4-11/h4H,3H2,1-2H3,(H,9,10,11).
What are the key properties of ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate?
ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 214.25 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-formamido-4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 14486436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).