C5H8F2N2 — CID 144864558
(1E)-1-N,2-difluoro-3-N-methylbuta-1,3-diene-1,3-diamine (PubChem CID 144864558) has the molecular formula C5H8F2N2 and a molecular weight of 134.13 g/mol. Its IUPAC name is (1E)-1-N,2-difluoro-3-N-methylbuta-1,3-diene-1,3-diamine.
| Compound Name | (1E)-1-N,2-difluoro-3-N-methylbuta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 144864558 |
| Molecular Formula | C5H8F2N2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | (1E)-1-N,2-difluoro-3-N-methylbuta-1,3-diene-1,3-diamine |
| SMILES | C=C(NC)/C(F)=C\NF |
| InChI | InChI=1S/C5H8F2N2/c1-4(8-2)5(6)3-9-7/h3,8-9H,1H2,2H3/b5-3+ |
| InChIKey | ZPJQDRQCWGKTOI-HWKANZROSA-N |
| XLogP | 1.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|