C12H21BN2O4 — CID 144864720
methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate (PubChem CID 144864720) has the molecular formula C12H21BN2O4 and a molecular weight of 268.12 g/mol. Its IUPAC name is methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate.
| Compound Name | methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 144864720 |
| Molecular Formula | C12H21BN2O4 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
| SMILES | COC(=O)C1C=C(B2OC(C)(C)C(C)(C)O2)N(C)N1 |
| InChI | InChI=1S/C12H21BN2O4/c1-11(2)12(3,4)19-13(18-11)9-7-8(10(16)17-6)14-15(9)5/h7-8,14H,1-6H3 |
| InChIKey | ZPSOULRYMNGNPD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|