C25H30FN5O6S — CID 144864891
4-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluoroanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;1,4-oxathiane (PubChem CID 144864891) has the molecular formula C25H30FN5O6S and a molecular weight of 547.61 g/mol. Its IUPAC name is 4-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluoroanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;1,4-oxathiane.
| Compound Name | 4-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluoroanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;1,4-oxathiane |
|---|---|
| PubChem CID | 144864891 |
| Molecular Formula | C25H30FN5O6S |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 4-[2-[[(3aR,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluoroanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;1,4-oxathiane |
| SMILES | C1CSCCO1.COC1CO[C@@H]2C(Oc3cc(F)ccc3Nc3ncnn4cc(C(N)=O)c(C)c34)CO[C@H]12 |
| InChI | InChI=1S/C21H22FN5O5.C4H8OS/c1-10-12(20(23)28)6-27-17(10)21(24-9-25-27)26-13-4-3-11(22)5-14(13)32-16-8-31-18-15(29-2)7-30-19(16)18;1-3-6-4-2-5-1/h3-6,9,15-16,18-19H,7-8H2,1-2H3,(H2,23,28)(H,24,25,26);1-4H2/t15?,16?,18-,19-;/m1./s1 |
| InChIKey | HCFHLSPKHUQEJR-OXPSVUKJSA-N |
| XLogP | 2.33 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |