C27H33FN6O2S2 — CID 144864949
4-(4-fluoro-2-hydroxyanilino)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;methylsulfanylbenzene;1-methylsulfanylpiperidine (PubChem CID 144864949) has the molecular formula C27H33FN6O2S2 and a molecular weight of 556.73 g/mol. Its IUPAC name is 4-(4-fluoro-2-hydroxyanilino)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;methylsulfanylbenzene;1-methylsulfanylpiperidine.
| Compound Name | 4-(4-fluoro-2-hydroxyanilino)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;methylsulfanylbenzene;1-methylsulfanylpiperidine |
|---|---|
| PubChem CID | 144864949 |
| Molecular Formula | C27H33FN6O2S2 |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 4-(4-fluoro-2-hydroxyanilino)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;methylsulfanylbenzene;1-methylsulfanylpiperidine |
| SMILES | CSN1CCCCC1.CSc1ccccc1.Cc1c(C(N)=O)cn2ncnc(Nc3ccc(F)cc3O)c12 |
| InChI | InChI=1S/C14H12FN5O2.C7H8S.C6H13NS/c1-7-9(13(16)22)5-20-12(7)14(17-6-18-20)19-10-3-2-8(15)4-11(10)21;2*1-8-7-5-3-2-4-6-7/h2-6,21H,1H3,(H2,16,22)(H,17,18,19);2-6H,1H3;2-6H2,1H3 |
| InChIKey | FFGLOMSCMLQJKJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 108.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|