About 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine
1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine (PubChem CID 144865414) has the molecular formula C15H21N4O+
and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine |
| PubChem CID | 144865414 |
| Molecular Formula | C15H21N4O+ |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine |
| SMILES | Cc1[nH][n+](Cc2ccc(CN(C)C)cc2)c(C)c1N=O |
| InChI | InChI=1S/C15H20N4O/c1-11-15(17-20)12(2)19(16-11)10-14-7-5-13(6-8-14)9-18(3)4/h5-8H,9-10H2,1-4H3/p+1 |
| InChIKey | FFPQHNOAUBVMKB-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 52.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine (CID 144865414) is 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine is Cc1[nH][n+](Cc2ccc(CN(C)C)cc2)c(C)c1N=O.
What is the InChIKey of 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine?
The InChIKey is FFPQHNOAUBVMKB-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H20N4O/c1-11-15(17-20)12(2)19(16-11)10-14-7-5-13(6-8-14)9-18(3)4/h5-8H,9-10H2,1-4H3/p+1.
What are the key properties of 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine?
1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine has a molecular weight of 273.36 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(3,5-dimethyl-4-nitroso-1H-pyrazol-2-ium-2-yl)methyl]phenyl]-N,N-dimethylmethanamine is sourced from PubChem (CID 144865414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).