About acetonitrile;1-propan-2-ylpiperidin-3-ol
acetonitrile;1-propan-2-ylpiperidin-3-ol (PubChem CID 144865621) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is acetonitrile;1-propan-2-ylpiperidin-3-ol.
Molecular Properties
| Compound Name | acetonitrile;1-propan-2-ylpiperidin-3-ol |
| PubChem CID | 144865621 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | acetonitrile;1-propan-2-ylpiperidin-3-ol |
| SMILES | CC#N.CC(C)N1CCCC(O)C1 |
| InChI | InChI=1S/C8H17NO.C2H3N/c1-7(2)9-5-3-4-8(10)6-9;1-2-3/h7-8,10H,3-6H2,1-2H3;1H3 |
| InChIKey | BOSBKSZWUCETOA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;1-propan-2-ylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;1-propan-2-ylpiperidin-3-ol?
The IUPAC name of acetonitrile;1-propan-2-ylpiperidin-3-ol (CID 144865621) is acetonitrile;1-propan-2-ylpiperidin-3-ol.
What is the SMILES notation for acetonitrile;1-propan-2-ylpiperidin-3-ol?
The canonical SMILES for acetonitrile;1-propan-2-ylpiperidin-3-ol is CC#N.CC(C)N1CCCC(O)C1.
What is the InChIKey of acetonitrile;1-propan-2-ylpiperidin-3-ol?
The InChIKey is BOSBKSZWUCETOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C2H3N/c1-7(2)9-5-3-4-8(10)6-9;1-2-3/h7-8,10H,3-6H2,1-2H3;1H3.
What are the key properties of acetonitrile;1-propan-2-ylpiperidin-3-ol?
acetonitrile;1-propan-2-ylpiperidin-3-ol has a molecular weight of 184.28 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;1-propan-2-ylpiperidin-3-ol is sourced from PubChem (CID 144865621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).