About 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole
3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole (PubChem CID 144866138) has the molecular formula C19H37N3O
and a molecular weight of 323.53 g/mol. Its IUPAC name is 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole.
Molecular Properties
| Compound Name | 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole |
| PubChem CID | 144866138 |
| Molecular Formula | C19H37N3O |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.29 |
| IUPAC Name | 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole |
| SMILES | CC.CC1CCC2(C1)CN(C)CCO2.Cc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C10H19NO.C7H12N2.C2H6/c1-9-3-4-10(7-9)8-11(2)5-6-12-10;1-6(2)9-5-4-7(3)8-9;1-2/h9H,3-8H2,1-2H3;4-6H,1-3H3;1-2H3 |
| InChIKey | FCDVGTVIULBGBG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole?
The IUPAC name of 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole (CID 144866138) is 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole.
What is the SMILES notation for 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole?
The canonical SMILES for 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole is CC.CC1CCC2(C1)CN(C)CCO2.Cc1ccn(C(C)C)n1.
What is the InChIKey of 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole?
The InChIKey is FCDVGTVIULBGBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.C7H12N2.C2H6/c1-9-3-4-10(7-9)8-11(2)5-6-12-10;1-6(2)9-5-4-7(3)8-9;1-2/h9H,3-8H2,1-2H3;4-6H,1-3H3;1-2H3.
What are the key properties of 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole?
3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole has a molecular weight of 323.53 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-dimethyl-6-oxa-9-azaspiro[4.5]decane;ethane;3-methyl-1-propan-2-ylpyrazole is sourced from PubChem (CID 144866138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).