C29H38N4O6S — CID 144867370
3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]propanoic acid;ethane (PubChem CID 144867370) has the molecular formula C29H38N4O6S and a molecular weight of 570.71 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]propanoic acid;ethane.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]propanoic acid;ethane |
|---|---|
| PubChem CID | 144867370 |
| Molecular Formula | C29H38N4O6S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]propanoic acid;ethane |
| SMILES | CC.COc1cc(C(CC(=O)O)c2ccc(C)c(CN3CCOc4ccccc4S3(=O)=O)c2)cc(N)c1N(C)N |
| InChI | InChI=1S/C27H32N4O6S.C2H6/c1-17-8-9-18(21(15-26(32)33)19-13-22(28)27(30(2)29)24(14-19)36-3)12-20(17)16-31-10-11-37-23-6-4-5-7-25(23)38(31,34)35;1-2/h4-9,12-14,21H,10-11,15-16,28-29H2,1-3H3,(H,32,33);1-2H3 |
| InChIKey | GMOKOSWXUKIOFW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 148.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|