C29H33F3N4O4S — CID 144867555
ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]-4-(trifluoromethyl)phenyl]propanoate (PubChem CID 144867555) has the molecular formula C29H33F3N4O4S and a molecular weight of 590.67 g/mol. Its IUPAC name is ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]-4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]-4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 144867555 |
| Molecular Formula | C29H33F3N4O4S |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[(1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]-4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(C(F)(F)F)c(CN2CCOc3ccccc3S2=O)c1)c1ccc(N(C)N)c(N)c1C |
| InChI | InChI=1S/C29H33F3N4O4S/c1-4-39-27(37)16-22(21-10-12-24(35(3)34)28(33)18(21)2)19-9-11-23(29(30,31)32)20(15-19)17-36-13-14-40-25-7-5-6-8-26(25)41(36)38/h5-12,15,22H,4,13-14,16-17,33-34H2,1-3H3 |
| InChIKey | KNFIZOMJJWWQSE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|