C28H31F3N4O4S — CID 144867583
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[[(4R)-4-methyl-1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 144867583) has the molecular formula C28H31F3N4O4S and a molecular weight of 576.64 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[[(4R)-4-methyl-1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[[(4R)-4-methyl-1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 144867583 |
| Molecular Formula | C28H31F3N4O4S |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-[[(4R)-4-methyl-1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | Cc1c(C(CC(=O)O)c2ccc(C(F)(F)F)c(CN3C[C@@H](C)Oc4ccccc4S3=O)c2)ccc(N(C)N)c1N |
| InChI | InChI=1S/C28H31F3N4O4S/c1-16-14-35(40(38)25-7-5-4-6-24(25)39-16)15-19-12-18(8-10-22(19)28(29,30)31)21(13-26(36)37)20-9-11-23(34(3)33)27(32)17(20)2/h4-12,16,21H,13-15,32-33H2,1-3H3,(H,36,37)/t16-,21?,40?/m1/s1 |
| InChIKey | LRXNFBGIKOKCEG-OMJHKYSKSA-N |
| XLogP | 4.82 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|