C21H24F3N3O4 — CID 144867695
ethyl 3-[3-diazenyl-5-methoxy-4-(methylamino)phenyl]-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]propanoate (PubChem CID 144867695) has the molecular formula C21H24F3N3O4 and a molecular weight of 439.43 g/mol. Its IUPAC name is ethyl 3-[3-diazenyl-5-methoxy-4-(methylamino)phenyl]-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 3-[3-diazenyl-5-methoxy-4-(methylamino)phenyl]-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 144867695 |
| Molecular Formula | C21H24F3N3O4 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | ethyl 3-[3-diazenyl-5-methoxy-4-(methylamino)phenyl]-3-[3-(hydroxymethyl)-4-(trifluoromethyl)phenyl]propanoate |
| SMILES | [H]/N=N/c1cc(C(CC(=O)OCC)c2ccc(C(F)(F)F)c(CO)c2)cc(OC)c1NC |
| InChI | InChI=1S/C21H24F3N3O4/c1-4-31-19(29)10-15(12-5-6-16(21(22,23)24)14(7-12)11-28)13-8-17(27-25)20(26-2)18(9-13)30-3/h5-9,15,25-26,28H,4,10-11H2,1-3H3/b27-25+ |
| InChIKey | MPXIDGNWTBZUPJ-IMVLJIQESA-N |
| XLogP | 5.00 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|