About 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one
2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one (PubChem CID 144868053) has the molecular formula C5H7N3O2S
and a molecular weight of 173.20 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one |
| PubChem CID | 144868053 |
| Molecular Formula | C5H7N3O2S |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one |
| SMILES | Cc1nn(CO)c(=O)[nH]c1=S |
| InChI | InChI=1S/C5H7N3O2S/c1-3-4(11)6-5(10)8(2-9)7-3/h9H,2H2,1H3,(H,6,10,11) |
| InChIKey | HJCPYPOCISXGPG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one?
The IUPAC name of 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one (CID 144868053) is 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one.
What is the SMILES notation for 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one?
The canonical SMILES for 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one is Cc1nn(CO)c(=O)[nH]c1=S.
What is the InChIKey of 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one?
The InChIKey is HJCPYPOCISXGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2S/c1-3-4(11)6-5(10)8(2-9)7-3/h9H,2H2,1H3,(H,6,10,11).
What are the key properties of 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one?
2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one has a molecular weight of 173.20 g/mol, XLogP of -0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-6-methyl-5-sulfanylidene-1,2,4-triazin-3-one is sourced from PubChem (CID 144868053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).