About ethane;3-methylpenta-1,4-diene
ethane;3-methylpenta-1,4-diene (PubChem CID 144868161) has the molecular formula C8H16
and a molecular weight of 112.22 g/mol. Its IUPAC name is ethane;3-methylpenta-1,4-diene.
Molecular Properties
| Compound Name | ethane;3-methylpenta-1,4-diene |
| PubChem CID | 144868161 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | ethane;3-methylpenta-1,4-diene |
| SMILES | C=CC(C)C=C.CC |
| InChI | InChI=1S/C6H10.C2H6/c1-4-6(3)5-2;1-2/h4-6H,1-2H2,3H3;1-2H3 |
| InChIKey | OHLPKRMVOBJIIF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylpenta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylpenta-1,4-diene?
The IUPAC name of ethane;3-methylpenta-1,4-diene (CID 144868161) is ethane;3-methylpenta-1,4-diene.
What is the SMILES notation for ethane;3-methylpenta-1,4-diene?
The canonical SMILES for ethane;3-methylpenta-1,4-diene is C=CC(C)C=C.CC.
What is the InChIKey of ethane;3-methylpenta-1,4-diene?
The InChIKey is OHLPKRMVOBJIIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10.C2H6/c1-4-6(3)5-2;1-2/h4-6H,1-2H2,3H3;1-2H3.
What are the key properties of ethane;3-methylpenta-1,4-diene?
ethane;3-methylpenta-1,4-diene has a molecular weight of 112.22 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylpenta-1,4-diene is sourced from PubChem (CID 144868161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).