C42H26IN5 — CID 144868789
18-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1λ3-iodacyclohexa-2,4,6-trien-3-yl)-4,18-diazapentacyclo[13.2.1.03,7.08,17.011,16]octadeca-1(17),2,5,7,9,11(16),12,14-octaene (PubChem CID 144868789) has the molecular formula C42H26IN5 and a molecular weight of 727.61 g/mol. Its IUPAC name is 18-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1λ3-iodacyclohexa-2,4,6-trien-3-yl)-4,18-diazapentacyclo[13.2.1.03,7.08,17.011,16]octadeca-1(17),2,5,7,9,11(16),12,14-octaene.
| Compound Name | 18-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1λ3-iodacyclohexa-2,4,6-trien-3-yl)-4,18-diazapentacyclo[13.2.1.03,7.08,17.011,16]octadeca-1(17),2,5,7,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 144868789 |
| Molecular Formula | C42H26IN5 |
| Molecular Weight | 727.61 g/mol |
| Exact Mass | 727.12 |
| IUPAC Name | 18-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(1λ3-iodacyclohexa-2,4,6-trien-3-yl)-4,18-diazapentacyclo[13.2.1.03,7.08,17.011,16]octadeca-1(17),2,5,7,9,11(16),12,14-octaene |
| SMILES | C1=CC(n2ccc3c4ccc5cccc6c5c4c(cc32)n6-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)=CI=C1 |
| InChI | InChI=1S/C42H26IN5/c1-3-9-28(10-4-1)40-44-41(29-11-5-2-6-12-29)46-42(45-40)30-16-19-31(20-17-30)48-35-15-7-13-27-18-21-34-33-22-24-47(32-14-8-23-43-26-32)36(33)25-37(48)39(34)38(27)35/h1-26H |
| InChIKey | OBASZIIGLMUAKM-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.61 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|