C22H29FN6O2 — CID 144869151
1-[2-[[(1E,3Z)-1,4-diamino-4-(5-fluoro-3-pyridinyl)buta-1,3-dienyl]amino]prop-2-enyl]-6-methyl-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione;ethane (PubChem CID 144869151) has the molecular formula C22H29FN6O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-[2-[[(1E,3Z)-1,4-diamino-4-(5-fluoro-3-pyridinyl)buta-1,3-dienyl]amino]prop-2-enyl]-6-methyl-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione;ethane.
| Compound Name | 1-[2-[[(1E,3Z)-1,4-diamino-4-(5-fluoro-3-pyridinyl)buta-1,3-dienyl]amino]prop-2-enyl]-6-methyl-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione;ethane |
|---|---|
| PubChem CID | 144869151 |
| Molecular Formula | C22H29FN6O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-[2-[[(1E,3Z)-1,4-diamino-4-(5-fluoro-3-pyridinyl)buta-1,3-dienyl]amino]prop-2-enyl]-6-methyl-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione;ethane |
| SMILES | C=C(CN1CCCC2=C1C(=O)N(C)C2=O)N/C(N)=C/C=C(\N)c1cncc(F)c1.CC |
| InChI | InChI=1S/C20H23FN6O2.C2H6/c1-12(11-27-7-3-4-15-18(27)20(29)26(2)19(15)28)25-17(23)6-5-16(22)13-8-14(21)10-24-9-13;1-2/h5-6,8-10,25H,1,3-4,7,11,22-23H2,2H3;1-2H3/b16-5-,17-6+; |
| InChIKey | MJNJTIWTSCGWPF-NJDCRQMHSA-N |
| XLogP | 1.80 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|