C21H23N5O3 — CID 144869233
2-(6-methyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[5-(N-prop-2-enylidenecarbamimidoyl)-2-bicyclo[4.1.0]hepta-2,4-dienyl]acetamide (PubChem CID 144869233) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-(6-methyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[5-(N-prop-2-enylidenecarbamimidoyl)-2-bicyclo[4.1.0]hepta-2,4-dienyl]acetamide.
| Compound Name | 2-(6-methyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[5-(N-prop-2-enylidenecarbamimidoyl)-2-bicyclo[4.1.0]hepta-2,4-dienyl]acetamide |
|---|---|
| PubChem CID | 144869233 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-(6-methyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[5-(N-prop-2-enylidenecarbamimidoyl)-2-bicyclo[4.1.0]hepta-2,4-dienyl]acetamide |
| SMILES | [H]/N=C(\N=C\C=C)C1=CC=C(NC(=O)CN2CCCC3=C2C(=O)N(C)C3=O)C2CC12 |
| InChI | InChI=1S/C21H23N5O3/c1-3-8-23-19(22)12-6-7-16(15-10-14(12)15)24-17(27)11-26-9-4-5-13-18(26)21(29)25(2)20(13)28/h3,6-8,14-15,22H,1,4-5,9-11H2,2H3,(H,24,27)/b22-19-,23-8+ |
| InChIKey | RCITTWLECLSXSO-IAYRYLBSSA-N |
| XLogP | 1.15 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|