C11H20O5 — CID 14486937
(1S,3R,4aR,5R,7S,7aS)-1,3-dimethoxy-7-methyl-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyran-5,7-diol (PubChem CID 14486937) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is (1S,3R,4aR,5R,7S,7aS)-1,3-dimethoxy-7-methyl-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyran-5,7-diol.
| Compound Name | (1S,3R,4aR,5R,7S,7aS)-1,3-dimethoxy-7-methyl-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyran-5,7-diol |
|---|---|
| PubChem CID | 14486937 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (1S,3R,4aR,5R,7S,7aS)-1,3-dimethoxy-7-methyl-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyran-5,7-diol |
| SMILES | CO[C@H]1C[C@@H]2[C@H]([C@@H](OC)O1)[C@@](C)(O)C[C@H]2O |
| InChI | InChI=1S/C11H20O5/c1-11(13)5-7(12)6-4-8(14-2)16-10(15-3)9(6)11/h6-10,12-13H,4-5H2,1-3H3/t6-,7+,8+,9+,10-,11-/m0/s1 |
| InChIKey | YBCFURRNWBFVNX-VDNGDJRNSA-N |
| XLogP | 0.10 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |