About decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide
decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide (PubChem CID 144869646) has the molecular formula C19H41NO
and a molecular weight of 299.54 g/mol. Its IUPAC name is decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide.
Molecular Properties
| Compound Name | decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide |
| PubChem CID | 144869646 |
| Molecular Formula | C19H41NO |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.32 |
| IUPAC Name | decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide |
| SMILES | CC.CC(=O)N(C)C=C(C)C.CCCCCCCCCC |
| InChI | InChI=1S/C10H22.C7H13NO.C2H6/c1-3-5-7-9-10-8-6-4-2;1-6(2)5-8(4)7(3)9;1-2/h3-10H2,1-2H3;5H,1-4H3;1-2H3 |
| InChIKey | PWBJLJNKUYBQNL-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide?
The IUPAC name of decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide (CID 144869646) is decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide.
What is the SMILES notation for decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide?
The canonical SMILES for decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide is CC.CC(=O)N(C)C=C(C)C.CCCCCCCCCC.
What is the InChIKey of decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide?
The InChIKey is PWBJLJNKUYBQNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.C7H13NO.C2H6/c1-3-5-7-9-10-8-6-4-2;1-6(2)5-8(4)7(3)9;1-2/h3-10H2,1-2H3;5H,1-4H3;1-2H3.
What are the key properties of decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide?
decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide has a molecular weight of 299.54 g/mol, XLogP of 6.56, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decane;ethane;N-methyl-N-(2-methylprop-1-enyl)acetamide is sourced from PubChem (CID 144869646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).