About 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane
3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane (PubChem CID 144869905) has the molecular formula C18H28N2S
and a molecular weight of 304.50 g/mol. Its IUPAC name is 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane.
Molecular Properties
| Compound Name | 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane |
| PubChem CID | 144869905 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane |
| SMILES | CC.CC.Cc1cc(N)cc(-c2cnc(C3CCC3)s2)c1 |
| InChI | InChI=1S/C14H16N2S.2C2H6/c1-9-5-11(7-12(15)6-9)13-8-16-14(17-13)10-3-2-4-10;2*1-2/h5-8,10H,2-4,15H2,1H3;2*1-2H3 |
| InChIKey | PHGSKAPFUBNHHL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane?
The IUPAC name of 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane (CID 144869905) is 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane.
What is the SMILES notation for 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane?
The canonical SMILES for 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane is CC.CC.Cc1cc(N)cc(-c2cnc(C3CCC3)s2)c1.
What is the InChIKey of 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane?
The InChIKey is PHGSKAPFUBNHHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2S.2C2H6/c1-9-5-11(7-12(15)6-9)13-8-16-14(17-13)10-3-2-4-10;2*1-2/h5-8,10H,2-4,15H2,1H3;2*1-2H3.
What are the key properties of 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane?
3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane has a molecular weight of 304.50 g/mol, XLogP of 6.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-cyclobutyl-1,3-thiazol-5-yl)-5-methylaniline;ethane is sourced from PubChem (CID 144869905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).