C15H24FN3O4 — CID 144869907
[5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]-4-fluoro-4-methyloxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 144869907) has the molecular formula C15H24FN3O4 and a molecular weight of 329.37 g/mol. Its IUPAC name is [5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]-4-fluoro-4-methyloxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]-4-fluoro-4-methyloxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 144869907 |
| Molecular Formula | C15H24FN3O4 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | [5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]-4-fluoro-4-methyloxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | C/N=C(N)/C=C\N(C=O)C1OC(COC(=O)C(C)C)CC1(C)F |
| InChI | InChI=1S/C15H24FN3O4/c1-10(2)13(21)22-8-11-7-15(3,16)14(23-11)19(9-20)6-5-12(17)18-4/h5-6,9-11,14H,7-8H2,1-4H3,(H2,17,18)/b6-5- |
| InChIKey | LPFRHZNHKCQVAD-WAYWQWQTSA-N |
| XLogP | 0.99 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|