C18H25ClFNO2 — CID 144870144
5-chloro-7-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one;propan-2-ylcyclohexane (PubChem CID 144870144) has the molecular formula C18H25ClFNO2 and a molecular weight of 341.85 g/mol. Its IUPAC name is 5-chloro-7-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one;propan-2-ylcyclohexane.
| Compound Name | 5-chloro-7-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one;propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 144870144 |
| Molecular Formula | C18H25ClFNO2 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 5-chloro-7-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one;propan-2-ylcyclohexane |
| SMILES | CC(C)C1CCCCC1.CN1Cc2cc(Cl)c(O)c(F)c2C1=O |
| InChI | InChI=1S/C9H7ClFNO2.C9H18/c1-12-3-4-2-5(10)8(13)7(11)6(4)9(12)14;1-8(2)9-6-4-3-5-7-9/h2,13H,3H2,1H3;8-9H,3-7H2,1-2H3 |
| InChIKey | KXJMJCRYPLWQGN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |