About fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate
fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate (PubChem CID 144870360) has the molecular formula C5H3ClFNO3
and a molecular weight of 179.53 g/mol. Its IUPAC name is fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate |
| PubChem CID | 144870360 |
| Molecular Formula | C5H3ClFNO3 |
| Molecular Weight | 179.53 g/mol |
| Exact Mass | 178.98 |
| IUPAC Name | fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate |
| SMILES | Cc1oc(Cl)nc1C(=O)OF |
| InChI | InChI=1S/C5H3ClFNO3/c1-2-3(4(9)11-7)8-5(6)10-2/h1H3 |
| InChIKey | YJONRMLRFIVFSM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate?
The IUPAC name of fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate (CID 144870360) is fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate is Cc1oc(Cl)nc1C(=O)OF.
What is the InChIKey of fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate?
The InChIKey is YJONRMLRFIVFSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClFNO3/c1-2-3(4(9)11-7)8-5(6)10-2/h1H3.
What are the key properties of fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate?
fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate has a molecular weight of 179.53 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2-chloro-5-methyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 144870360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).