C21H28F2N8O2S — CID 144870432
8-[amino-[(Z)-1-amino-3,3-difluoroprop-1-en-2-yl]amino]-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide;ethane (PubChem CID 144870432) has the molecular formula C21H28F2N8O2S and a molecular weight of 494.57 g/mol. Its IUPAC name is 8-[amino-[(Z)-1-amino-3,3-difluoroprop-1-en-2-yl]amino]-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide;ethane.
| Compound Name | 8-[amino-[(Z)-1-amino-3,3-difluoroprop-1-en-2-yl]amino]-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide;ethane |
|---|---|
| PubChem CID | 144870432 |
| Molecular Formula | C21H28F2N8O2S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 8-[amino-[(Z)-1-amino-3,3-difluoroprop-1-en-2-yl]amino]-N-[(2S)-1-hydrazinyl-1-oxopropan-2-yl]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxamide;ethane |
| SMILES | CC.Cc1ccc(-c2cnc3c(N(N)/C(=C\N)C(F)F)cc(C(=O)N[C@@H](C)C(=O)NN)cn23)s1 |
| InChI | InChI=1S/C19H22F2N8O2S.C2H6/c1-9-3-4-15(32-9)14-7-25-17-12(29(24)13(6-22)16(20)21)5-11(8-28(14)17)19(31)26-10(2)18(30)27-23;1-2/h3-8,10,16H,22-24H2,1-2H3,(H,26,31)(H,27,30);1-2H3/b13-6-;/t10-;/m0./s1 |
| InChIKey | CEPTUFMBSITVKP-CMJSLVHPSA-N |
| XLogP | 2.25 |
| TPSA | 156.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|