C20H28N4O6 — CID 144870623
1-N-[5-(2,5-dioxopyrrol-1-yl)pentyl]-1-N'-[2-oxo-2-(3-oxopropylamino)ethyl]cyclobutane-1,1-dicarboxamide (PubChem CID 144870623) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is 1-N-[5-(2,5-dioxopyrrol-1-yl)pentyl]-1-N'-[2-oxo-2-(3-oxopropylamino)ethyl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N-[5-(2,5-dioxopyrrol-1-yl)pentyl]-1-N'-[2-oxo-2-(3-oxopropylamino)ethyl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 144870623 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-N-[5-(2,5-dioxopyrrol-1-yl)pentyl]-1-N'-[2-oxo-2-(3-oxopropylamino)ethyl]cyclobutane-1,1-dicarboxamide |
| SMILES | O=CCCNC(=O)CNC(=O)C1(C(=O)NCCCCCN2C(=O)C=CC2=O)CCC1 |
| InChI | InChI=1S/C20H28N4O6/c25-13-5-11-21-15(26)14-23-19(30)20(8-4-9-20)18(29)22-10-2-1-3-12-24-16(27)6-7-17(24)28/h6-7,13H,1-5,8-12,14H2,(H,21,26)(H,22,29)(H,23,30) |
| InChIKey | MGCFCUMOOJTNMN-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|