C37H40O9S — CID 14487145
methyl (2S,4R,5R,6R)-6-[(1R)-2-(4-methylphenyl)sulfonyloxy-1-phenylmethoxyethyl]-4,5-bis(phenylmethoxy)oxane-2-carboxylate (PubChem CID 14487145) has the molecular formula C37H40O9S and a molecular weight of 660.79 g/mol. Its IUPAC name is methyl (2S,4R,5R,6R)-6-[(1R)-2-(4-methylphenyl)sulfonyloxy-1-phenylmethoxyethyl]-4,5-bis(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,4R,5R,6R)-6-[(1R)-2-(4-methylphenyl)sulfonyloxy-1-phenylmethoxyethyl]-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 14487145 |
| Molecular Formula | C37H40O9S |
| Molecular Weight | 660.79 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | methyl (2S,4R,5R,6R)-6-[(1R)-2-(4-methylphenyl)sulfonyloxy-1-phenylmethoxyethyl]-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]([C@@H](COS(=O)(=O)c2ccc(C)cc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C37H40O9S/c1-27-18-20-31(21-19-27)47(39,40)45-26-34(43-24-29-14-8-4-9-15-29)36-35(44-25-30-16-10-5-11-17-30)32(22-33(46-36)37(38)41-2)42-23-28-12-6-3-7-13-28/h3-21,32-36H,22-26H2,1-2H3/t32-,33+,34-,35-,36-/m1/s1 |
| InChIKey | LHYYHBOXSHSTOS-MWAROKLZSA-N |
| XLogP | 5.79 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.79 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|