C13H20N2 — CID 144871859
2,8-di(propan-2-yl)-2,3-dihydroimidazo[1,2-a]pyridine (PubChem CID 144871859) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 2,8-di(propan-2-yl)-2,3-dihydroimidazo[1,2-a]pyridine.
| Compound Name | 2,8-di(propan-2-yl)-2,3-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 144871859 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2,8-di(propan-2-yl)-2,3-dihydroimidazo[1,2-a]pyridine |
| SMILES | CC(C)C1=CC=CN2CC(C(C)C)N=C12 |
| InChI | InChI=1S/C13H20N2/c1-9(2)11-6-5-7-15-8-12(10(3)4)14-13(11)15/h5-7,9-10,12H,8H2,1-4H3 |
| InChIKey | WZSPOINGGYQFAO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |