C34H46N4O7 — CID 144871868
methyl (2S,4R)-4-(3-but-3-enyl-7-methoxyquinoxalin-2-yl)oxy-1-[3,3-dimethyl-2-[[(1R,2R)-2-[(Z)-pent-2-enyl]cyclopropyl]oxycarbonylamino]butanoyl]pyrrolidine-2-carboxylate (PubChem CID 144871868) has the molecular formula C34H46N4O7 and a molecular weight of 622.76 g/mol. Its IUPAC name is methyl (2S,4R)-4-(3-but-3-enyl-7-methoxyquinoxalin-2-yl)oxy-1-[3,3-dimethyl-2-[[(1R,2R)-2-[(Z)-pent-2-enyl]cyclopropyl]oxycarbonylamino]butanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-(3-but-3-enyl-7-methoxyquinoxalin-2-yl)oxy-1-[3,3-dimethyl-2-[[(1R,2R)-2-[(Z)-pent-2-enyl]cyclopropyl]oxycarbonylamino]butanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 144871868 |
| Molecular Formula | C34H46N4O7 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | methyl (2S,4R)-4-(3-but-3-enyl-7-methoxyquinoxalin-2-yl)oxy-1-[3,3-dimethyl-2-[[(1R,2R)-2-[(Z)-pent-2-enyl]cyclopropyl]oxycarbonylamino]butanoyl]pyrrolidine-2-carboxylate |
| SMILES | C=CCCc1nc2ccc(OC)cc2nc1O[C@@H]1C[C@@H](C(=O)OC)N(C(=O)C(NC(=O)O[C@@H]2C[C@H]2C/C=C\CC)C(C)(C)C)C1 |
| InChI | InChI=1S/C34H46N4O7/c1-8-10-12-13-21-17-28(21)45-33(41)37-29(34(3,4)5)31(39)38-20-23(19-27(38)32(40)43-7)44-30-25(14-11-9-2)35-24-16-15-22(42-6)18-26(24)36-30/h9-10,12,15-16,18,21,23,27-29H,2,8,11,13-14,17,19-20H2,1,3-7H3,(H,37,41)/b12-10-/t21-,23-,27+,28-,29?/m1/s1 |
| InChIKey | RSRCEVBCIFISPD-OOFWCUNGSA-N |
| XLogP | 5.16 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|